C27H58O7Si3 — CID 14408414
[(2R,3R,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl] acetate (PubChem CID 14408414) has the molecular formula C27H58O7Si3 and a molecular weight of 579.01 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 14408414 |
| Molecular Formula | C27H58O7Si3 |
| Molecular Weight | 579.01 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H58O7Si3/c1-19(28)31-23-22(34-37(16,17)27(8,9)10)21(33-36(14,15)26(5,6)7)20(32-24(23)29-11)18-30-35(12,13)25(2,3)4/h20-24H,18H2,1-17H3/t20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | HCPWNEUNEGDCCX-OYTPZHDJSA-N |
| XLogP | 7.09 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.01 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|