C18H44O5Si4 — CID 11733119
trimethyl-[(2S,3R,4R,5S)-2-methyl-3,5,6-tris(trimethylsilyloxy)oxan-4-yl]oxysilane (PubChem CID 11733119) has the molecular formula C18H44O5Si4 and a molecular weight of 452.89 g/mol. Its IUPAC name is trimethyl-[(2S,3R,4R,5S)-2-methyl-3,5,6-tris(trimethylsilyloxy)oxan-4-yl]oxysilane.
| Compound Name | trimethyl-[(2S,3R,4R,5S)-2-methyl-3,5,6-tris(trimethylsilyloxy)oxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 11733119 |
| Molecular Formula | C18H44O5Si4 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | trimethyl-[(2S,3R,4R,5S)-2-methyl-3,5,6-tris(trimethylsilyloxy)oxan-4-yl]oxysilane |
| SMILES | C[C@@H]1OC(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C18H44O5Si4/c1-14-15(20-24(2,3)4)16(21-25(5,6)7)17(22-26(8,9)10)18(19-14)23-27(11,12)13/h14-18H,1-13H3/t14-,15+,16+,17-,18?/m0/s1 |
| InChIKey | QQOFWFOBJUGLLJ-KIUIKQMISA-N |
| XLogP | 5.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|