C34H71BrO7Si4 — CID 73441688
[(2R,3S,4R,5S,6S)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-yl] (E)-3-bromo-2-methylprop-2-enoate (PubChem CID 73441688) has the molecular formula C34H71BrO7Si4 and a molecular weight of 784.18 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-yl] (E)-3-bromo-2-methylprop-2-enoate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-yl] (E)-3-bromo-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 73441688 |
| Molecular Formula | C34H71BrO7Si4 |
| Molecular Weight | 784.18 g/mol |
| Exact Mass | 782.35 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-yl] (E)-3-bromo-2-methylprop-2-enoate |
| SMILES | CC[Si](CC)(CC)OC[C@@H]1O[C@H](OC(=O)/C(C)=C/Br)[C@@H](O[Si](CC)(CC)CC)[C@H](O[Si](CC)(CC)CC)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H71BrO7Si4/c1-14-43(15-2,16-3)37-27-29-30(40-44(17-4,18-5)19-6)31(41-45(20-7,21-8)22-9)32(42-46(23-10,24-11)25-12)34(38-29)39-33(36)28(13)26-35/h26,29-32,34H,14-25,27H2,1-13H3/b28-26+/t29-,30-,31+,32-,34+/m0/s1 |
| InChIKey | AGAOUEKNHQLTBS-FQDBNNAPSA-N |
| XLogP | 10.75 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.18 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|