C23H46O6Si2 — CID 134835383
[(3R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (E)-but-2-enoate (PubChem CID 134835383) has the molecular formula C23H46O6Si2 and a molecular weight of 474.79 g/mol. Its IUPAC name is [(3R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (E)-but-2-enoate.
| Compound Name | [(3R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 134835383 |
| Molecular Formula | C23H46O6Si2 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | [(3R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@@H]1C(C)O[C@H](OC)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O6Si2/c1-14-15-17(24)27-18-16(2)26-21(25-9)20(29-31(12,13)23(6,7)8)19(18)28-30(10,11)22(3,4)5/h14-16,18-21H,1-13H3/b15-14+/t16?,18-,19?,20?,21+/m1/s1 |
| InChIKey | LCDXIBZQQGBYNQ-KYFYLGHUSA-N |
| XLogP | 5.65 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|