C17H32O6Si — CID 24879702
[(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-methyl-6-prop-2-enoxyoxan-3-yl] acetate (PubChem CID 24879702) has the molecular formula C17H32O6Si and a molecular weight of 360.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-methyl-6-prop-2-enoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-methyl-6-prop-2-enoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 24879702 |
| Molecular Formula | C17H32O6Si |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-methyl-6-prop-2-enoxyoxan-3-yl] acetate |
| SMILES | C=CCO[C@H]1O[C@H](C)[C@H](OC(C)=O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O6Si/c1-9-10-20-16-15(23-24(7,8)17(4,5)6)13(19)14(11(2)21-16)22-12(3)18/h9,11,13-16,19H,1,10H2,2-8H3/t11-,13+,14+,15-,16+/m1/s1 |
| InChIKey | YDZDRLRZOSCYNO-CHUNWDLHSA-N |
| XLogP | 2.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|