C27H55LiO5Si3 — CID 164677549
lithium [3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-propa-1,2-dienoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 164677549) has the molecular formula C27H55LiO5Si3 and a molecular weight of 550.93 g/mol. Its IUPAC name is lithium [3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-propa-1,2-dienoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | lithium [3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-propa-1,2-dienoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 164677549 |
| Molecular Formula | C27H55LiO5Si3 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | lithium [3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-propa-1,2-dienoxyoxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C=[C-]OC1CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)O1.[Li+] |
| InChI | InChI=1S/C27H55O5Si3.Li/c1-17-18-28-23-19-21(31-34(13,14)26(5,6)7)24(32-35(15,16)27(8,9)10)22(30-23)20-29-33(11,12)25(2,3)4;/h21-24H,1,19-20H2,2-16H3;/q-1;+1 |
| InChIKey | VVVCBIPRXPPJGX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|