C19H46O6Si4 — CID 22214285
[(2R,3R,4S,5S,6R)-2-methoxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane (PubChem CID 22214285) has the molecular formula C19H46O6Si4 and a molecular weight of 482.92 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2-methoxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3R,4S,5S,6R)-2-methoxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 22214285 |
| Molecular Formula | C19H46O6Si4 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2-methoxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane |
| SMILES | CO[C@@H]1O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C19H46O6Si4/c1-20-19-18(25-29(11,12)13)17(24-28(8,9)10)16(23-27(5,6)7)15(22-19)14-21-26(2,3)4/h15-19H,14H2,1-13H3/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | UIDVFSCIFIMDHO-ICBNADEASA-N |
| XLogP | 4.87 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|