C27H66O8Si6 — CID 91754126
trimethyl-[3-trimethylsilyloxy-2-[(2R,3S,4R,5R,6S)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxypropoxy]silane (PubChem CID 91754126) has the molecular formula C27H66O8Si6 and a molecular weight of 687.33 g/mol. Its IUPAC name is trimethyl-[3-trimethylsilyloxy-2-[(2R,3S,4R,5R,6S)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxypropoxy]silane.
| Compound Name | trimethyl-[3-trimethylsilyloxy-2-[(2R,3S,4R,5R,6S)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxypropoxy]silane |
|---|---|
| PubChem CID | 91754126 |
| Molecular Formula | C27H66O8Si6 |
| Molecular Weight | 687.33 g/mol |
| Exact Mass | 686.34 |
| IUPAC Name | trimethyl-[3-trimethylsilyloxy-2-[(2R,3S,4R,5R,6S)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxypropoxy]silane |
| SMILES | C[Si](C)(C)OCC(CO[Si](C)(C)C)O[C@@H]1O[C@@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C27H66O8Si6/c1-36(2,3)28-19-22(20-29-37(4,5)6)31-27-26(35-41(16,17)18)25(34-40(13,14)15)24(33-39(10,11)12)23(32-27)21-30-38(7,8)9/h22-27H,19-21H2,1-18H3/t23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | ADPMNKPURASUCV-SHZNSVIDSA-N |
| XLogP | 7.31 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.33 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|