C22H38O3Si — CID 54357334
6,10-dimethyl-12-(oxan-2-yloxy)-1-trimethylsilyldodeca-6,10-dien-1-yn-3-ol (PubChem CID 54357334) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is 6,10-dimethyl-12-(oxan-2-yloxy)-1-trimethylsilyldodeca-6,10-dien-1-yn-3-ol.
| Compound Name | 6,10-dimethyl-12-(oxan-2-yloxy)-1-trimethylsilyldodeca-6,10-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 54357334 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 6,10-dimethyl-12-(oxan-2-yloxy)-1-trimethylsilyldodeca-6,10-dien-1-yn-3-ol |
| SMILES | CC(=CCOC1CCCCO1)CCC=C(C)CCC(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C22H38O3Si/c1-19(12-13-21(23)15-18-26(3,4)5)9-8-10-20(2)14-17-25-22-11-6-7-16-24-22/h9,14,21-23H,6-8,10-13,16-17H2,1-5H3 |
| InChIKey | UKANAQWPBMAJNG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|