C32H54O6Si2 — CID 139616243
(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(4-hydroxybut-2-ynyl)-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-ol (PubChem CID 139616243) has the molecular formula C32H54O6Si2 and a molecular weight of 590.95 g/mol. Its IUPAC name is (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(4-hydroxybut-2-ynyl)-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-ol.
| Compound Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(4-hydroxybut-2-ynyl)-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 139616243 |
| Molecular Formula | C32H54O6Si2 |
| Molecular Weight | 590.95 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(4-hydroxybut-2-ynyl)-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-ol |
| SMILES | C/C(C#CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C1(O)CC#CCO)=C/COC1CCCCO1 |
| InChI | InChI=1S/C32H54O6Si2/c1-25(19-23-36-28-16-12-15-22-35-28)17-18-26-24-27(37-39(8,9)30(2,3)4)29(32(26,34)20-13-14-21-33)38-40(10,11)31(5,6)7/h19,24,27-29,33-34H,12,15-16,20-23H2,1-11H3/b25-19-/t27-,28?,29+,32?/m1/s1 |
| InChIKey | CTXXMWKMENZTAD-ONMCOJJZSA-N |
| XLogP | 6.32 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.95 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|