C30H54O4Si — CID 10458879
(7E,11E)-4,8,12-trimethyl-13-(oxan-2-yloxy)-1-tri(propan-2-yl)silyloxytrideca-7,11-dien-2-yn-4-ol (PubChem CID 10458879) has the molecular formula C30H54O4Si and a molecular weight of 506.84 g/mol. Its IUPAC name is (7E,11E)-4,8,12-trimethyl-13-(oxan-2-yloxy)-1-tri(propan-2-yl)silyloxytrideca-7,11-dien-2-yn-4-ol.
| Compound Name | (7E,11E)-4,8,12-trimethyl-13-(oxan-2-yloxy)-1-tri(propan-2-yl)silyloxytrideca-7,11-dien-2-yn-4-ol |
|---|---|
| PubChem CID | 10458879 |
| Molecular Formula | C30H54O4Si |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | (7E,11E)-4,8,12-trimethyl-13-(oxan-2-yloxy)-1-tri(propan-2-yl)silyloxytrideca-7,11-dien-2-yn-4-ol |
| SMILES | C/C(=C\CCC(C)(O)C#CCO[Si](C(C)C)(C(C)C)C(C)C)CC/C=C(\C)COC1CCCCO1 |
| InChI | InChI=1S/C30H54O4Si/c1-24(2)35(25(3)4,26(5)6)34-22-14-20-30(9,31)19-13-17-27(7)15-12-16-28(8)23-33-29-18-10-11-21-32-29/h16-17,24-26,29,31H,10-13,15,18-19,21-23H2,1-9H3/b27-17+,28-16+ |
| InChIKey | HWHIZEGFXGLWPB-NBCKFKMNSA-N |
| XLogP | 7.93 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|