C28H50O3Si — CID 12000505
tert-butyl-dimethyl-[(6E,10E)-3,7,11-trimethyl-14-(oxan-2-yloxy)tetradeca-6,10-dien-1-yn-3-yl]oxysilane (PubChem CID 12000505) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(6E,10E)-3,7,11-trimethyl-14-(oxan-2-yloxy)tetradeca-6,10-dien-1-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(6E,10E)-3,7,11-trimethyl-14-(oxan-2-yloxy)tetradeca-6,10-dien-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 12000505 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | tert-butyl-dimethyl-[(6E,10E)-3,7,11-trimethyl-14-(oxan-2-yloxy)tetradeca-6,10-dien-1-yn-3-yl]oxysilane |
| SMILES | C#CC(C)(CC/C=C(\C)CC/C=C(\C)CCCOC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O3Si/c1-10-28(7,31-32(8,9)27(4,5)6)21-14-18-24(2)16-13-17-25(3)19-15-23-30-26-20-11-12-22-29-26/h1,17-18,26H,11-16,19-23H2,2-9H3/b24-18+,25-17+ |
| InChIKey | ZASZEORLNJAVGP-NSTZATIKSA-N |
| XLogP | 8.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|