C32H58O5Si — CID 10415169
[(7E,11E)-4-(methoxymethoxy)-4,8,12-trimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-2-ynoxy]-tri(propan-2-yl)silane (PubChem CID 10415169) has the molecular formula C32H58O5Si and a molecular weight of 550.90 g/mol. Its IUPAC name is [(7E,11E)-4-(methoxymethoxy)-4,8,12-trimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-2-ynoxy]-tri(propan-2-yl)silane.
| Compound Name | [(7E,11E)-4-(methoxymethoxy)-4,8,12-trimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-2-ynoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10415169 |
| Molecular Formula | C32H58O5Si |
| Molecular Weight | 550.90 g/mol |
| Exact Mass | 550.41 |
| IUPAC Name | [(7E,11E)-4-(methoxymethoxy)-4,8,12-trimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-2-ynoxy]-tri(propan-2-yl)silane |
| SMILES | COCOC(C)(C#CCO[Si](C(C)C)(C(C)C)C(C)C)CC/C=C(\C)CC/C=C(\C)COC1CCCCO1 |
| InChI | InChI=1S/C32H58O5Si/c1-26(2)38(27(3)4,28(5)6)37-23-15-21-32(9,36-25-33-10)20-14-18-29(7)16-13-17-30(8)24-35-31-19-11-12-22-34-31/h17-18,26-28,31H,11-14,16,19-20,22-25H2,1-10H3/b29-18+,30-17+ |
| InChIKey | AOTZCMAGXWHCKE-PEWMYGTDSA-N |
| XLogP | 8.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.90 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|