C28H51IO3Si — CID 12000506
tert-butyl-[(1E,6E,10E)-1-iodo-3,7,11-trimethyl-14-(oxan-2-yloxy)tetradeca-1,6,10-trien-3-yl]oxy-dimethylsilane (PubChem CID 12000506) has the molecular formula C28H51IO3Si and a molecular weight of 590.70 g/mol. Its IUPAC name is tert-butyl-[(1E,6E,10E)-1-iodo-3,7,11-trimethyl-14-(oxan-2-yloxy)tetradeca-1,6,10-trien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,6E,10E)-1-iodo-3,7,11-trimethyl-14-(oxan-2-yloxy)tetradeca-1,6,10-trien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 12000506 |
| Molecular Formula | C28H51IO3Si |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | tert-butyl-[(1E,6E,10E)-1-iodo-3,7,11-trimethyl-14-(oxan-2-yloxy)tetradeca-1,6,10-trien-3-yl]oxy-dimethylsilane |
| SMILES | C/C(=C\CCC(C)(/C=C/I)O[Si](C)(C)C(C)(C)C)CC/C=C(\C)CCCOC1CCCCO1 |
| InChI | InChI=1S/C28H51IO3Si/c1-24(14-11-15-25(2)17-13-23-31-26-18-9-10-22-30-26)16-12-19-28(6,20-21-29)32-33(7,8)27(3,4)5/h15-16,20-21,26H,9-14,17-19,22-23H2,1-8H3/b21-20+,24-16+,25-15+ |
| InChIKey | PZXXBSXANNKNJR-HNCDZPSXSA-N |
| XLogP | 9.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|