C18H35IO2Si — CID 15213975
tert-butyl-[(1S)-1-(3,7-dimethylocta-1,6-dien-3-yloxy)-2-iodoethoxy]-dimethylsilane (PubChem CID 15213975) has the molecular formula C18H35IO2Si and a molecular weight of 438.47 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-(3,7-dimethylocta-1,6-dien-3-yloxy)-2-iodoethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-(3,7-dimethylocta-1,6-dien-3-yloxy)-2-iodoethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15213975 |
| Molecular Formula | C18H35IO2Si |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | tert-butyl-[(1S)-1-(3,7-dimethylocta-1,6-dien-3-yloxy)-2-iodoethoxy]-dimethylsilane |
| SMILES | C=CC(C)(CCC=C(C)C)O[C@H](CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35IO2Si/c1-10-18(7,13-11-12-15(2)3)20-16(14-19)21-22(8,9)17(4,5)6/h10,12,16H,1,11,13-14H2,2-9H3/t16-,18?/m0/s1 |
| InChIKey | BADUIYWWSWPRNS-ATNAJCNCSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|