C17H33IO3Si — CID 11546670
[(1R,4S)-4-(1-butoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11546670) has the molecular formula C17H33IO3Si and a molecular weight of 440.44 g/mol. Its IUPAC name is [(1R,4S)-4-(1-butoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,4S)-4-(1-butoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11546670 |
| Molecular Formula | C17H33IO3Si |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [(1R,4S)-4-(1-butoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCOC(CI)O[C@@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H33IO3Si/c1-7-8-11-19-16(13-18)20-14-9-10-15(12-14)21-22(5,6)17(2,3)4/h9-10,14-16H,7-8,11-13H2,1-6H3/t14-,15+,16?/m1/s1 |
| InChIKey | HQBOYTCBBWZLHM-YSPPHNQVSA-N |
| XLogP | 5.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|