C20H32O3 — CID 15237477
(6E,10E)-3,7,11-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-ol (PubChem CID 15237477) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (6E,10E)-3,7,11-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-ol.
| Compound Name | (6E,10E)-3,7,11-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 15237477 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (6E,10E)-3,7,11-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-1-yn-3-ol |
| SMILES | C#CC(C)(O)CC/C=C(\C)CC/C=C(\C)COC1CCCCO1 |
| InChI | InChI=1S/C20H32O3/c1-5-20(4,21)14-9-12-17(2)10-8-11-18(3)16-23-19-13-6-7-15-22-19/h1,11-12,19,21H,6-10,13-16H2,2-4H3/b17-12+,18-11+ |
| InChIKey | FSOLNPBEZIBCNY-VQVMMYKWSA-N |
| XLogP | 4.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|