C21H39IO4Si2 — CID 11124377
(1R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethoxyethoxy)-2-iodo-1-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol (PubChem CID 11124377) has the molecular formula C21H39IO4Si2 and a molecular weight of 538.62 g/mol. Its IUPAC name is (1R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethoxyethoxy)-2-iodo-1-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol.
| Compound Name | (1R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethoxyethoxy)-2-iodo-1-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11124377 |
| Molecular Formula | C21H39IO4Si2 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | (1R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethoxyethoxy)-2-iodo-1-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol |
| SMILES | CCOC(C)O[C@@H]1C=C(I)[C@@](O)(CC#C[Si](C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39IO4Si2/c1-11-24-16(2)25-17-15-18(22)21(23,13-12-14-27(6,7)8)19(17)26-28(9,10)20(3,4)5/h15-17,19,23H,11,13H2,1-10H3/t16?,17-,19+,21+/m1/s1 |
| InChIKey | KPHLSEWJNMFBOL-DRQZDJIPSA-N |
| XLogP | 5.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|