C24H47IO4Si3 — CID 11050334
tert-butyl-[(1S,2R,5R)-5-(1-ethoxyethoxy)-3-iodo-2-trimethylsilyloxy-2-(3-trimethylsilylprop-2-ynyl)cyclopent-3-en-1-yl]oxy-dimethylsilane (PubChem CID 11050334) has the molecular formula C24H47IO4Si3 and a molecular weight of 610.80 g/mol. Its IUPAC name is tert-butyl-[(1S,2R,5R)-5-(1-ethoxyethoxy)-3-iodo-2-trimethylsilyloxy-2-(3-trimethylsilylprop-2-ynyl)cyclopent-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R,5R)-5-(1-ethoxyethoxy)-3-iodo-2-trimethylsilyloxy-2-(3-trimethylsilylprop-2-ynyl)cyclopent-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11050334 |
| Molecular Formula | C24H47IO4Si3 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | tert-butyl-[(1S,2R,5R)-5-(1-ethoxyethoxy)-3-iodo-2-trimethylsilyloxy-2-(3-trimethylsilylprop-2-ynyl)cyclopent-3-en-1-yl]oxy-dimethylsilane |
| SMILES | CCOC(C)O[C@@H]1C=C(I)[C@](CC#C[Si](C)(C)C)(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H47IO4Si3/c1-14-26-19(2)27-20-18-21(25)24(29-31(9,10)11,16-15-17-30(6,7)8)22(20)28-32(12,13)23(3,4)5/h18-20,22H,14,16H2,1-13H3/t19?,20-,22+,24+/m1/s1 |
| InChIKey | IFKFLRQDZDJSSG-WNCYPCHTSA-N |
| XLogP | 7.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|