C29H55IO5Si2 — CID 101207681
tert-butyl-[(E)-4-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]-1-(2-ethyloxiran-2-yl)but-3-en-2-yl]oxy-dimethylsilane (PubChem CID 101207681) has the molecular formula C29H55IO5Si2 and a molecular weight of 666.83 g/mol. Its IUPAC name is tert-butyl-[(E)-4-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]-1-(2-ethyloxiran-2-yl)but-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]-1-(2-ethyloxiran-2-yl)but-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101207681 |
| Molecular Formula | C29H55IO5Si2 |
| Molecular Weight | 666.83 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | tert-butyl-[(E)-4-[[(1R,4S)-4-(1-ethoxy-2-iodoethoxy)cyclopent-2-en-1-yl]oxy-di(propan-2-yl)silyl]-1-(2-ethyloxiran-2-yl)but-3-en-2-yl]oxy-dimethylsilane |
| SMILES | CCOC(CI)O[C@@H]1C=C[C@H](O[Si](/C=C/C(CC2(CC)CO2)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C29H55IO5Si2/c1-12-29(21-32-29)19-26(34-36(10,11)28(7,8)9)16-17-37(22(3)4,23(5)6)35-25-15-14-24(18-25)33-27(20-30)31-13-2/h14-17,22-27H,12-13,18-21H2,1-11H3/b17-16+/t24-,25+,26?,27?,29?/m1/s1 |
| InChIKey | QOUSJZXVLKFAFF-WNHVVBPYSA-N |
| XLogP | 8.33 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.83 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|