C24H40I2O4Si2 — CID 11146899
tert-butyl-[(1S,2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-iodoethynyl)-2-(3-iodoprop-2-ynyl)-2-(methoxymethoxy)cyclopent-3-en-1-yl]oxy-dimethylsilane (PubChem CID 11146899) has the molecular formula C24H40I2O4Si2 and a molecular weight of 702.56 g/mol. Its IUPAC name is tert-butyl-[(1S,2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-iodoethynyl)-2-(3-iodoprop-2-ynyl)-2-(methoxymethoxy)cyclopent-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-iodoethynyl)-2-(3-iodoprop-2-ynyl)-2-(methoxymethoxy)cyclopent-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11146899 |
| Molecular Formula | C24H40I2O4Si2 |
| Molecular Weight | 702.56 g/mol |
| Exact Mass | 702.06 |
| IUPAC Name | tert-butyl-[(1S,2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-iodoethynyl)-2-(3-iodoprop-2-ynyl)-2-(methoxymethoxy)cyclopent-3-en-1-yl]oxy-dimethylsilane |
| SMILES | COCO[C@@]1(CC#CI)C(C#CI)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40I2O4Si2/c1-22(2,3)31(8,9)29-20-17-19(13-16-26)24(14-12-15-25,28-18-27-7)21(20)30-32(10,11)23(4,5)6/h17,20-21H,14,18H2,1-11H3/t20-,21+,24+/m1/s1 |
| InChIKey | TYDOBBJIKHNKKG-DPLHUUCSSA-N |
| XLogP | 7.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|