C27H40O7Si — CID 10940099
(4S,6R,10S,11S,12R)-11-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-12-(1-ethoxyethoxy)-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyn-10-ol (PubChem CID 10940099) has the molecular formula C27H40O7Si and a molecular weight of 504.70 g/mol. Its IUPAC name is (4S,6R,10S,11S,12R)-11-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-12-(1-ethoxyethoxy)-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyn-10-ol.
| Compound Name | (4S,6R,10S,11S,12R)-11-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-12-(1-ethoxyethoxy)-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyn-10-ol |
|---|---|
| PubChem CID | 10940099 |
| Molecular Formula | C27H40O7Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (4S,6R,10S,11S,12R)-11-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-12-(1-ethoxyethoxy)-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyn-10-ol |
| SMILES | CCOC(C)O[C@@H]1C=C2C#C[C@]3([C@H]4COC(C)(C)O4)O[C@@H]3C#CC[C@@]2(O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H40O7Si/c1-10-29-18(2)31-20-16-19-13-15-27(22-17-30-25(6,7)32-22)21(33-27)12-11-14-26(19,28)23(20)34-35(8,9)24(3,4)5/h16,18,20-23,28H,10,14,17H2,1-9H3/t18?,20-,21-,22-,23+,26+,27+/m1/s1 |
| InChIKey | MUAWYJJUAAVLFK-NNTBUNHXSA-N |
| XLogP | 3.52 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|