C23H32O6Si — CID 102172285
(1R,2R,6R,12R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-14,14-dimethyl-6-trimethylsilyloxy-13,15-dioxatricyclo[7.6.0.01,12]pentadec-9-en-3,7-diyn-2-ol (PubChem CID 102172285) has the molecular formula C23H32O6Si and a molecular weight of 432.59 g/mol. Its IUPAC name is (1R,2R,6R,12R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-14,14-dimethyl-6-trimethylsilyloxy-13,15-dioxatricyclo[7.6.0.01,12]pentadec-9-en-3,7-diyn-2-ol.
| Compound Name | (1R,2R,6R,12R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-14,14-dimethyl-6-trimethylsilyloxy-13,15-dioxatricyclo[7.6.0.01,12]pentadec-9-en-3,7-diyn-2-ol |
|---|---|
| PubChem CID | 102172285 |
| Molecular Formula | C23H32O6Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (1R,2R,6R,12R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-14,14-dimethyl-6-trimethylsilyloxy-13,15-dioxatricyclo[7.6.0.01,12]pentadec-9-en-3,7-diyn-2-ol |
| SMILES | CC1(C)OC[C@@H]([C@]2(O[Si](C)(C)C)C#CC3=CC[C@H]4OC(C)(C)O[C@@]34[C@H](O)C#CC2)O1 |
| InChI | InChI=1S/C23H32O6Si/c1-20(2)25-15-19(27-20)22(29-30(5,6)7)13-8-9-17(24)23-16(12-14-22)10-11-18(23)26-21(3,4)28-23/h10,17-19,24H,11,13,15H2,1-7H3/t17-,18-,19+,22-,23-/m1/s1 |
| InChIKey | ZWQHSSRHMOGXGU-GWWNCLRWSA-N |
| XLogP | 2.72 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|