C21H26O6 — CID 102172282
(1R,2R,6R,12R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methoxy-14,14-dimethyl-13,15-dioxatricyclo[7.6.0.01,12]pentadec-9-en-3,7-diyn-2-ol (PubChem CID 102172282) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (1R,2R,6R,12R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methoxy-14,14-dimethyl-13,15-dioxatricyclo[7.6.0.01,12]pentadec-9-en-3,7-diyn-2-ol.
| Compound Name | (1R,2R,6R,12R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methoxy-14,14-dimethyl-13,15-dioxatricyclo[7.6.0.01,12]pentadec-9-en-3,7-diyn-2-ol |
|---|---|
| PubChem CID | 102172282 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1R,2R,6R,12R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methoxy-14,14-dimethyl-13,15-dioxatricyclo[7.6.0.01,12]pentadec-9-en-3,7-diyn-2-ol |
| SMILES | CO[C@@]1([C@@H]2COC(C)(C)O2)C#CC2=CC[C@H]3OC(C)(C)O[C@@]23[C@H](O)C#CC1 |
| InChI | InChI=1S/C21H26O6/c1-18(2)24-13-17(26-18)20(23-5)11-6-7-15(22)21-14(10-12-20)8-9-16(21)25-19(3,4)27-21/h8,15-17,22H,9,11,13H2,1-5H3/t15-,16-,17+,20-,21-/m1/s1 |
| InChIKey | MFWTUFZXCJNNRA-IJERAIBMSA-N |
| XLogP | 1.51 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|