C21H26O7 — CID 10905221
(4S,6R,10S,11S,12R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-12-(1-ethoxyethoxy)-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyne-10,11-diol (PubChem CID 10905221) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is (4S,6R,10S,11S,12R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-12-(1-ethoxyethoxy)-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyne-10,11-diol.
| Compound Name | (4S,6R,10S,11S,12R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-12-(1-ethoxyethoxy)-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyne-10,11-diol |
|---|---|
| PubChem CID | 10905221 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (4S,6R,10S,11S,12R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-12-(1-ethoxyethoxy)-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyne-10,11-diol |
| SMILES | CCOC(C)O[C@@H]1C=C2C#C[C@]3([C@H]4COC(C)(C)O4)O[C@@H]3C#CC[C@@]2(O)[C@H]1O |
| InChI | InChI=1S/C21H26O7/c1-5-24-13(2)26-15-11-14-8-10-21(17-12-25-19(3,4)27-17)16(28-21)7-6-9-20(14,23)18(15)22/h11,13,15-18,22-23H,5,9,12H2,1-4H3/t13?,15-,16-,17-,18+,20+,21+/m1/s1 |
| InChIKey | FPIRIMZMSLGFSX-MGLUGCIESA-N |
| XLogP | 0.49 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|