C17H18O5 — CID 11197431
(1R,3S,7R,12S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxatricyclo[8.3.0.01,3]tridec-10-en-4,8-diyne-7,12-diol (PubChem CID 11197431) has the molecular formula C17H18O5 and a molecular weight of 303.32 g/mol. Its IUPAC name is (1R,3S,7R,12S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxatricyclo[8.3.0.01,3]tridec-10-en-4,8-diyne-7,12-diol.
| Compound Name | (1R,3S,7R,12S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxatricyclo[8.3.0.01,3]tridec-10-en-4,8-diyne-7,12-diol |
|---|---|
| PubChem CID | 11197431 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (1R,3S,7R,12S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxatricyclo[8.3.0.01,3]tridec-10-en-4,8-diyne-7,12-diol |
| SMILES | CC1(C)OC[C@H]([C@@]2(O)CC#C[C@@H]3O[C@@]34C[C@H](O)C=C4C#[13C]2)O1 |
| InChI | InChI=1S/C17H18O5/c1-15(2)20-10-14(21-15)16(19)6-3-4-13-17(22-13)9-12(18)8-11(17)5-7-16/h8,12-14,18-19H,6,9-10H2,1-2H3/t12-,13+,14-,16-,17-/m1/s1/i7+1 |
| InChIKey | VSJSVIOEHVVDNQ-AIQFWZDLSA-N |
| XLogP | 0.11 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|