C23H40O6 — CID 159650560
(3aS,4S,6aS)-4-ethyl-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-ol;(3S)-3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-ol;methane (PubChem CID 159650560) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (3aS,4S,6aS)-4-ethyl-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-ol;(3S)-3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-ol;methane.
| Compound Name | (3aS,4S,6aS)-4-ethyl-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-ol;(3S)-3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-ol;methane |
|---|---|
| PubChem CID | 159650560 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (3aS,4S,6aS)-4-ethyl-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-ol;(3S)-3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-ol;methane |
| SMILES | C.C=C[C@@H]1OC(C)(C)O[C@@H]1[C@@](O)(C=C)CC.CC[C@]1(O)C=C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H20O3.C10H16O3.CH4/c1-6-9-10(12(13,7-2)8-3)15-11(4,5)14-9;1-4-10(11)6-5-7-8(10)13-9(2,3)12-7;/h6-7,9-10,13H,1-2,8H2,3-5H3;5-8,11H,4H2,1-3H3;1H4/t9-,10-,12+;7-,8-,10-;/m00./s1 |
| InChIKey | MRMYGFCIVUPXSW-MGNWKKFZSA-N |
| XLogP | 3.87 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|