C35H62O6Si3 — CID 11050626
(2S,6R,10R,10aR)-2,6,10a-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-10-ol (PubChem CID 11050626) has the molecular formula C35H62O6Si3 and a molecular weight of 663.13 g/mol. Its IUPAC name is (2S,6R,10R,10aR)-2,6,10a-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-10-ol.
| Compound Name | (2S,6R,10R,10aR)-2,6,10a-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-10-ol |
|---|---|
| PubChem CID | 11050626 |
| Molecular Formula | C35H62O6Si3 |
| Molecular Weight | 663.13 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | (2S,6R,10R,10aR)-2,6,10a-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-10-ol |
| SMILES | CC1(C)OC[C@H]([C@]2(O[Si](C)(C)C(C)(C)C)C#CC3=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@]3(O[Si](C)(C)C(C)(C)C)[C@H](O)C#CC2)O1 |
| InChI | InChI=1S/C35H62O6Si3/c1-30(2,3)42(12,13)39-27-23-26-20-22-34(29-25-37-33(10,11)38-29,40-43(14,15)31(4,5)6)21-18-19-28(36)35(26,24-27)41-44(16,17)32(7,8)9/h23,27-29,36H,21,24-25H2,1-17H3/t27-,28-,29-,34-,35-/m1/s1 |
| InChIKey | UNJCKBRGHXIFJF-HMFGTHPRSA-N |
| XLogP | 8.15 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.13 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|