C27H47NO6Si2 — CID 11168674
(1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy(213C)but-1-ynyl]cyclopent-2-ene-1-carbonitrile (PubChem CID 11168674) has the molecular formula C27H47NO6Si2 and a molecular weight of 538.84 g/mol. Its IUPAC name is (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy(213C)but-1-ynyl]cyclopent-2-ene-1-carbonitrile.
| Compound Name | (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy(213C)but-1-ynyl]cyclopent-2-ene-1-carbonitrile |
|---|---|
| PubChem CID | 11168674 |
| Molecular Formula | C27H47NO6Si2 |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy(213C)but-1-ynyl]cyclopent-2-ene-1-carbonitrile |
| SMILES | CC1(C)OC[C@H]([C@@](O)(CO)[13C]#CC2=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]2(C#N)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H47NO6Si2/c1-23(2,3)35(9,10)33-21-15-20(27(16-21,18-28)34-36(11,12)24(4,5)6)13-14-26(30,19-29)22-17-31-25(7,8)32-22/h15,21-22,29-30H,16-17,19H2,1-12H3/t21-,22-,26+,27+/m1/s1/i14+1 |
| InChIKey | CQEOYXSQWPYJRA-AYOHIMDVSA-N |
| XLogP | 4.87 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|