C35H62O6Si3 — CID 11365847
(2S,6R,7R,10aR)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6,10a-tris(triethylsilyloxy)-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-7-ol (PubChem CID 11365847) has the molecular formula C35H62O6Si3 and a molecular weight of 663.13 g/mol. Its IUPAC name is (2S,6R,7R,10aR)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6,10a-tris(triethylsilyloxy)-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-7-ol.
| Compound Name | (2S,6R,7R,10aR)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6,10a-tris(triethylsilyloxy)-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-7-ol |
|---|---|
| PubChem CID | 11365847 |
| Molecular Formula | C35H62O6Si3 |
| Molecular Weight | 663.13 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | (2S,6R,7R,10aR)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6,10a-tris(triethylsilyloxy)-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-7-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C=C2C#C[C@](O[Si](CC)(CC)CC)([C@@H]3COC(C)(C)O3)[C@H](O)C#CC[C@@]2(O[Si](CC)(CC)CC)C1 |
| InChI | InChI=1S/C35H62O6Si3/c1-12-42(13-2,14-3)39-30-26-29-23-25-35(32-28-37-33(10,11)38-32,41-44(18-7,19-8)20-9)31(36)22-21-24-34(29,27-30)40-43(15-4,16-5)17-6/h26,30-32,36H,12-20,24,27-28H2,1-11H3/t30-,31-,32+,34-,35-/m1/s1 |
| InChIKey | LTIUFSWSBPBDIP-FFWRVQFCSA-N |
| XLogP | 8.15 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.13 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|