C29H48O5Si2 — CID 11410028
[(1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-triethylsilylethynyl)oxiran-2-yl]ethynyl]cyclopent-2-en-1-yl]methanol (PubChem CID 11410028) has the molecular formula C29H48O5Si2 and a molecular weight of 532.87 g/mol. Its IUPAC name is [(1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-triethylsilylethynyl)oxiran-2-yl]ethynyl]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-triethylsilylethynyl)oxiran-2-yl]ethynyl]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 11410028 |
| Molecular Formula | C29H48O5Si2 |
| Molecular Weight | 532.87 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | [(1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-triethylsilylethynyl)oxiran-2-yl]ethynyl]cyclopent-2-en-1-yl]methanol |
| SMILES | CC[Si](C#C[C@H]1O[C@]1(C#CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1CO)[C@H]1COC(C)(C)O1)(CC)CC |
| InChI | InChI=1S/C29H48O5Si2/c1-11-36(12-2,13-3)17-15-25-29(33-25,26-21-31-28(7,8)32-26)16-14-22-18-24(19-23(22)20-30)34-35(9,10)27(4,5)6/h18,23-26,30H,11-13,19-21H2,1-10H3/t23-,24-,25-,26-,29+/m1/s1 |
| InChIKey | OMWOFOUQPHMYGQ-FSJVOCHISA-N |
| XLogP | 5.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.87 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|