C23H32O5Si — CID 11407397
(4S,6R,9R,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyn-9-ol (PubChem CID 11407397) has the molecular formula C23H32O5Si and a molecular weight of 416.59 g/mol. Its IUPAC name is (4S,6R,9R,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyn-9-ol.
| Compound Name | (4S,6R,9R,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyn-9-ol |
|---|---|
| PubChem CID | 11407397 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (4S,6R,9R,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxatricyclo[8.3.0.04,6]tridec-1(13)-en-2,7-diyn-9-ol |
| SMILES | CC1(C)OC[C@H]([C@]23C#CC4=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]4[C@@H](O)C#C[C@H]2O3)O1 |
| InChI | InChI=1S/C23H32O5Si/c1-21(2,3)29(6,7)28-16-12-15-10-11-23(20-14-25-22(4,5)26-20)19(27-23)9-8-18(24)17(15)13-16/h12,16-20,24H,13-14H2,1-7H3/t16-,17+,18+,19-,20-,23+/m1/s1 |
| InChIKey | NQPUJXMEPDBSTC-AGKSVDAPSA-N |
| XLogP | 2.99 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|