C25H44O4Si — CID 25111071
(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-[(3R)-3-methyl-1,4-dioxaspiro[4.5]decan-3-yl]non-7-en-3-yn-2-ol (PubChem CID 25111071) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is (2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-[(3R)-3-methyl-1,4-dioxaspiro[4.5]decan-3-yl]non-7-en-3-yn-2-ol.
| Compound Name | (2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-[(3R)-3-methyl-1,4-dioxaspiro[4.5]decan-3-yl]non-7-en-3-yn-2-ol |
|---|---|
| PubChem CID | 25111071 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-[(3R)-3-methyl-1,4-dioxaspiro[4.5]decan-3-yl]non-7-en-3-yn-2-ol |
| SMILES | CC(C)=C[C@@H](CC#C[C@H](O)C[C@]1(C)COC2(CCCCC2)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O4Si/c1-20(2)17-22(28-30(7,8)23(3,4)5)14-12-13-21(26)18-24(6)19-27-25(29-24)15-10-9-11-16-25/h17,21-22,26H,9-11,14-16,18-19H2,1-8H3/t21-,22+,24+/m0/s1 |
| InChIKey | VYEWXSZHWPXOKI-WMTXJRDZSA-N |
| XLogP | 5.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|