C27H46O5Si — CID 25111073
[(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-[(3R)-3-methyl-1,4-dioxaspiro[4.5]decan-3-yl]non-7-en-3-yn-2-yl] acetate (PubChem CID 25111073) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is [(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-[(3R)-3-methyl-1,4-dioxaspiro[4.5]decan-3-yl]non-7-en-3-yn-2-yl] acetate.
| Compound Name | [(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-[(3R)-3-methyl-1,4-dioxaspiro[4.5]decan-3-yl]non-7-en-3-yn-2-yl] acetate |
|---|---|
| PubChem CID | 25111073 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | [(2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-[(3R)-3-methyl-1,4-dioxaspiro[4.5]decan-3-yl]non-7-en-3-yn-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C#CC[C@H](C=C(C)C)O[Si](C)(C)C(C)(C)C)C[C@]1(C)COC2(CCCCC2)O1 |
| InChI | InChI=1S/C27H46O5Si/c1-21(2)18-23(31-33(8,9)25(4,5)6)14-13-15-24(30-22(3)28)19-26(7)20-29-27(32-26)16-11-10-12-17-27/h18,23-24H,10-12,14,16-17,19-20H2,1-9H3/t23-,24+,26-/m1/s1 |
| InChIKey | BZAIOLIKTSOAFE-RMTZWNOUSA-N |
| XLogP | 6.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|