C20H38O5Si — CID 10981936
methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enoate (PubChem CID 10981936) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enoate.
| Compound Name | methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enoate |
|---|---|
| PubChem CID | 10981936 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enoate |
| SMILES | COC(=O)/C=C(\C)[C@H](C[C@H]1OC(C)(C)OC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O5Si/c1-14(12-17(21)22-9)15(24-26(10,11)18(2,3)4)13-16-19(5,6)25-20(7,8)23-16/h12,15-16H,13H2,1-11H3/b14-12+/t15-,16+/m0/s1 |
| InChIKey | YAMRBHDSZOFGSC-KBYULJEUSA-N |
| XLogP | 4.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|