C26H42O6Si2 — CID 101181942
[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyloxiran-2-yl]ethynyl]-5-trimethylsilyloxycyclopenten-1-yl]methanol (PubChem CID 101181942) has the molecular formula C26H42O6Si2 and a molecular weight of 506.79 g/mol. Its IUPAC name is [(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyloxiran-2-yl]ethynyl]-5-trimethylsilyloxycyclopenten-1-yl]methanol.
| Compound Name | [(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyloxiran-2-yl]ethynyl]-5-trimethylsilyloxycyclopenten-1-yl]methanol |
|---|---|
| PubChem CID | 101181942 |
| Molecular Formula | C26H42O6Si2 |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | [(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyloxiran-2-yl]ethynyl]-5-trimethylsilyloxycyclopenten-1-yl]methanol |
| SMILES | C#C[C@H]1O[C@]1(C#C[C@]1(O[Si](C)(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)C=C1CO)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C26H42O6Si2/c1-12-21-26(30-21,22-18-28-24(5,6)29-22)14-13-25(32-33(7,8)9)16-20(15-19(25)17-27)31-34(10,11)23(2,3)4/h1,15,20-22,27H,16-18H2,2-11H3/t20-,21+,22+,25-,26-/m0/s1 |
| InChIKey | KGCSTMXLSXBPIN-MKLAZCRDSA-N |
| XLogP | 4.22 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|