C27H48O5Si2 — CID 102247056
[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-triethylsilyloxiran-2-yl]ethynyl]cyclopent-2-en-1-yl]methanol (PubChem CID 102247056) has the molecular formula C27H48O5Si2 and a molecular weight of 508.85 g/mol. Its IUPAC name is [(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-triethylsilyloxiran-2-yl]ethynyl]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-triethylsilyloxiran-2-yl]ethynyl]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 102247056 |
| Molecular Formula | C27H48O5Si2 |
| Molecular Weight | 508.85 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | [(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-triethylsilyloxiran-2-yl]ethynyl]cyclopent-2-en-1-yl]methanol |
| SMILES | CC[Si](CC)(CC)[C@@H]1O[C@@]1(C#CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CO)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C27H48O5Si2/c1-11-34(12-2,13-3)24-27(31-24,23-19-29-26(7,8)30-23)15-14-20-16-22(17-21(20)18-28)32-33(9,10)25(4,5)6/h16,21-24,28H,11-13,17-19H2,1-10H3/t21-,22+,23+,24-,27-/m0/s1 |
| InChIKey | ODBDCIXMPPBLPM-RPAYPMEESA-N |
| XLogP | 5.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|