C33H58O4Si3 — CID 134885267
[(8Z,14R,15S)-1,14-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-15-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134885267) has the molecular formula C33H58O4Si3 and a molecular weight of 603.08 g/mol. Its IUPAC name is [(8Z,14R,15S)-1,14-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-15-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(8Z,14R,15S)-1,14-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-15-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134885267 |
| Molecular Formula | C33H58O4Si3 |
| Molecular Weight | 603.08 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | [(8Z,14R,15S)-1,14-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-15-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C/C1=C\COCC#CCC2(O[Si](C)(C)C(C)(C)C)C(=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)C#C1 |
| InChI | InChI=1S/C33H58O4Si3/c1-26-19-20-27-25-28(35-38(11,12)30(2,3)4)29(36-39(13,14)31(5,6)7)33(27,22-17-18-23-34-24-21-26)37-40(15,16)32(8,9)10/h21,25,28-29H,22-24H2,1-16H3/b26-21+/t28-,29+,33?/m1/s1 |
| InChIKey | QCULWMNHGBMXMQ-VFZULTPLSA-N |
| XLogP | 8.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.08 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|