C21H34O2Si2 — CID 102119816
tert-butyl-dimethyl-[4-[(2S,3R)-2-(2-trimethylsilylethynyl)-1-oxaspiro[2.4]hept-4-en-4-yl]but-3-ynoxy]silane (PubChem CID 102119816) has the molecular formula C21H34O2Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-[(2S,3R)-2-(2-trimethylsilylethynyl)-1-oxaspiro[2.4]hept-4-en-4-yl]but-3-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-[(2S,3R)-2-(2-trimethylsilylethynyl)-1-oxaspiro[2.4]hept-4-en-4-yl]but-3-ynoxy]silane |
|---|---|
| PubChem CID | 102119816 |
| Molecular Formula | C21H34O2Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | tert-butyl-dimethyl-[4-[(2S,3R)-2-(2-trimethylsilylethynyl)-1-oxaspiro[2.4]hept-4-en-4-yl]but-3-ynoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC#CC1=CCC[C@@]12O[C@H]2C#C[Si](C)(C)C |
| InChI | InChI=1S/C21H34O2Si2/c1-20(2,3)25(7,8)22-16-10-9-12-18-13-11-15-21(18)19(23-21)14-17-24(4,5)6/h13,19H,10-11,15-16H2,1-8H3/t19-,21+/m0/s1 |
| InChIKey | SBRNYNJZHBUQBE-PZJWPPBQSA-N |
| XLogP | 5.14 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|