C39H73BrO3Si2Sn — CID 139763901
2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)cyclopent-2-en-1-ol (PubChem CID 139763901) has the molecular formula C39H73BrO3Si2Sn and a molecular weight of 844.80 g/mol. Its IUPAC name is 2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)cyclopent-2-en-1-ol.
| Compound Name | 2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 139763901 |
| Molecular Formula | C39H73BrO3Si2Sn |
| Molecular Weight | 844.80 g/mol |
| Exact Mass | 844.33 |
| IUPAC Name | 2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)cyclopent-2-en-1-ol |
| SMILES | CCCC[Sn](C#CC(C)(C)CC(C#CCC1(O)CC(O[Si](C)(C)C(C)(C)C)C=C1Br)O[Si](CC)(CC)CC)(CCCC)CCCC |
| InChI | InChI=1S/C27H46BrO3Si2.3C4H9.Sn/c1-12-26(8,9)20-22(31-33(13-2,14-3)15-4)17-16-18-27(29)21-23(19-24(27)28)30-32(10,11)25(5,6)7;3*1-3-4-2;/h19,22-23,29H,13-15,18,20-21H2,2-11H3;3*1,3-4H2,2H3; |
| InChIKey | AZWHUZLCKUIISJ-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.80 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|