C33H59BrO2SiSn — CID 14985555
2-bromo-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)cyclopent-2-en-1-ol (PubChem CID 14985555) has the molecular formula C33H59BrO2SiSn and a molecular weight of 714.53 g/mol. Its IUPAC name is 2-bromo-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)cyclopent-2-en-1-ol.
| Compound Name | 2-bromo-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 14985555 |
| Molecular Formula | C33H59BrO2SiSn |
| Molecular Weight | 714.53 g/mol |
| Exact Mass | 714.25 |
| IUPAC Name | 2-bromo-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)cyclopent-2-en-1-ol |
| SMILES | CCCC[Sn](C#CC(C)(C)CC(C#CCC1(O)CCC=C1Br)O[Si](CC)(CC)CC)(CCCC)CCCC |
| InChI | InChI=1S/C21H32BrO2Si.3C4H9.Sn/c1-7-20(5,6)17-18(24-25(8-2,9-3)10-4)13-11-15-21(23)16-12-14-19(21)22;3*1-3-4-2;/h14,18,23H,8-10,12,15-17H2,2-6H3;3*1,3-4H2,2H3; |
| InChIKey | OJVWNXDXXIUOTG-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.53 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|