C17H34O3Si — CID 11099074
(3Z,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethylhepta-3,6-diene-2,5-diol (PubChem CID 11099074) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is (3Z,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethylhepta-3,6-diene-2,5-diol.
| Compound Name | (3Z,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethylhepta-3,6-diene-2,5-diol |
|---|---|
| PubChem CID | 11099074 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (3Z,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethylhepta-3,6-diene-2,5-diol |
| SMILES | C=C(C)[C@@](O)(/C=C\C(C)(C)O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-13(2)17(19,12-11-16(7,8)18)14(3)20-21(9,10)15(4,5)6/h11-12,14,18-19H,1H2,2-10H3/b12-11-/t14-,17+/m1/s1 |
| InChIKey | VBGCAWUAZFYYOM-PFQLYRODSA-N |
| XLogP | 4.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|