C21H36O2Si — CID 135021699
(2E,6R,8E,12E)-14-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradeca-2,8,12-trien-10-yn-1-ol (PubChem CID 135021699) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (2E,6R,8E,12E)-14-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradeca-2,8,12-trien-10-yn-1-ol.
| Compound Name | (2E,6R,8E,12E)-14-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradeca-2,8,12-trien-10-yn-1-ol |
|---|---|
| PubChem CID | 135021699 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (2E,6R,8E,12E)-14-[tert-butyl(dimethyl)silyl]oxy-6-methyltetradeca-2,8,12-trien-10-yn-1-ol |
| SMILES | C[C@@H](C/C=C/C#C/C=C/CO[Si](C)(C)C(C)(C)C)CC/C=C/CO |
| InChI | InChI=1S/C21H36O2Si/c1-20(17-13-11-14-18-22)16-12-9-7-8-10-15-19-23-24(5,6)21(2,3)4/h9-12,14-15,20,22H,13,16-19H2,1-6H3/b12-9+,14-11+,15-10+/t20-/m0/s1 |
| InChIKey | WHZPCISEDHCNBW-GDUAKHIHSA-N |
| XLogP | 5.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|