C18H32N2O3Si — CID 10893562
prop-2-enyl (2S,4R)-4-cyano-2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 10893562) has the molecular formula C18H32N2O3Si and a molecular weight of 352.55 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-cyano-2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-cyano-2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10893562 |
| Molecular Formula | C18H32N2O3Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-cyano-2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](C#N)C[C@H]1CO[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C18H32N2O3Si/c1-8-9-22-17(21)20-12-15(11-19)10-16(20)13-23-24(6,7)18(4,5)14(2)3/h8,14-16H,1,9-10,12-13H2,2-7H3/t15-,16-/m0/s1 |
| InChIKey | WSOZRBYACKBOJJ-HOTGVXAUSA-N |
| XLogP | 4.18 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|