C16H28N2O3Si — CID 19971418
prop-2-enyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(cyanomethyl)pyrrolidine-1-carboxylate (PubChem CID 19971418) has the molecular formula C16H28N2O3Si and a molecular weight of 324.50 g/mol. Its IUPAC name is prop-2-enyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(cyanomethyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(cyanomethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19971418 |
| Molecular Formula | C16H28N2O3Si |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | prop-2-enyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(cyanomethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(O[Si](C)(C)C(C)(C)C)CC1CC#N |
| InChI | InChI=1S/C16H28N2O3Si/c1-7-10-20-15(19)18-12-14(11-13(18)8-9-17)21-22(5,6)16(2,3)4/h7,13-14H,1,8,10-12H2,2-6H3 |
| InChIKey | DOOWFCQODXXQGJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|