C27H50O4Si2 — CID 53465584
(1R,3S,4aR,7aS,8R,8aR)-1,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-3,4a,5,6,7,7a,8,8a-octahydrocyclopenta[f][2]benzofuran-8-carbaldehyde (PubChem CID 53465584) has the molecular formula C27H50O4Si2 and a molecular weight of 494.87 g/mol. Its IUPAC name is (1R,3S,4aR,7aS,8R,8aR)-1,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-3,4a,5,6,7,7a,8,8a-octahydrocyclopenta[f][2]benzofuran-8-carbaldehyde.
| Compound Name | (1R,3S,4aR,7aS,8R,8aR)-1,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-3,4a,5,6,7,7a,8,8a-octahydrocyclopenta[f][2]benzofuran-8-carbaldehyde |
|---|---|
| PubChem CID | 53465584 |
| Molecular Formula | C27H50O4Si2 |
| Molecular Weight | 494.87 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | (1R,3S,4aR,7aS,8R,8aR)-1,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-3,4a,5,6,7,7a,8,8a-octahydrocyclopenta[f][2]benzofuran-8-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@](C)(CO[Si](C)(C)C(C)(C)C)[C@H]2C1=C[C@@H]1CCC[C@@H]1[C@H]2C=O |
| InChI | InChI=1S/C27H50O4Si2/c1-25(2,3)32(8,9)29-17-23-21-15-19-13-12-14-20(19)22(16-28)24(21)27(7,31-23)18-30-33(10,11)26(4,5)6/h15-16,19-20,22-24H,12-14,17-18H2,1-11H3/t19-,20-,22+,23+,24-,27-/m0/s1 |
| InChIKey | KEADNTGBIVCZML-CPUAHJQSSA-N |
| XLogP | 6.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.87 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|