C22H36O4Si — CID 88657522
1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(oxan-2-yl)-6-oxo-1,2,3,3a,7,7a-hexahydroindene-5-carbaldehyde (PubChem CID 88657522) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(oxan-2-yl)-6-oxo-1,2,3,3a,7,7a-hexahydroindene-5-carbaldehyde.
| Compound Name | 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(oxan-2-yl)-6-oxo-1,2,3,3a,7,7a-hexahydroindene-5-carbaldehyde |
|---|---|
| PubChem CID | 88657522 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(oxan-2-yl)-6-oxo-1,2,3,3a,7,7a-hexahydroindene-5-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C2CC(=O)C(C=O)=CC2CC1C1CCCCO1 |
| InChI | InChI=1S/C22H36O4Si/c1-22(2,3)27(4,5)26-14-19-17-12-20(24)16(13-23)10-15(17)11-18(19)21-8-6-7-9-25-21/h10,13,15,17-19,21H,6-9,11-12,14H2,1-5H3 |
| InChIKey | BUEOFZBGWAFOLV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|