C23H43O7PSi — CID 170518338
[(2E,3aR,4S,5R,6aS)-2-(2-dimethoxyphosphorylethylidene)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 170518338) has the molecular formula C23H43O7PSi and a molecular weight of 490.65 g/mol. Its IUPAC name is [(2E,3aR,4S,5R,6aS)-2-(2-dimethoxyphosphorylethylidene)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2E,3aR,4S,5R,6aS)-2-(2-dimethoxyphosphorylethylidene)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 170518338 |
| Molecular Formula | C23H43O7PSi |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | [(2E,3aR,4S,5R,6aS)-2-(2-dimethoxyphosphorylethylidene)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COP(=O)(C/C=C1\C[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](OC3CCCCO3)C[C@@H]2O1)OC |
| InChI | InChI=1S/C23H43O7PSi/c1-23(2,3)32(6,7)28-16-19-18-14-17(11-13-31(24,25-4)26-5)29-20(18)15-21(19)30-22-10-8-9-12-27-22/h11,18-22H,8-10,12-16H2,1-7H3/b17-11+/t18-,19-,20+,21-,22?/m1/s1 |
| InChIKey | SCQPNKZZUSILIY-DTQSJERHSA-N |
| XLogP | 5.71 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|