C23H42O7SSi — CID 87561375
1-[(2R,5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-2-yl]ethanesulfonic acid (PubChem CID 87561375) has the molecular formula C23H42O7SSi and a molecular weight of 490.74 g/mol. Its IUPAC name is 1-[(2R,5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-2-yl]ethanesulfonic acid.
| Compound Name | 1-[(2R,5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-2-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 87561375 |
| Molecular Formula | C23H42O7SSi |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 1-[(2R,5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-2-yl]ethanesulfonic acid |
| SMILES | CC([C@H]1CC=C[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](OC3CCCCO3)C[C@@H]2O1)S(=O)(=O)O |
| InChI | InChI=1S/C23H42O7SSi/c1-16(31(24,25)26)19-11-9-10-17-18(15-28-32(5,6)23(2,3)4)21(14-20(17)29-19)30-22-12-7-8-13-27-22/h9-10,16-22H,7-8,11-15H2,1-6H3,(H,24,25,26)/t16?,17-,18-,19-,20+,21-,22?/m1/s1 |
| InChIKey | IOTPPPGPEBOZBE-ZVVIPAQGSA-N |
| XLogP | 4.55 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|