C24H40O6Si — CID 68753729
3-[(2R,5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-2-yl]prop-2-enoic acid (PubChem CID 68753729) has the molecular formula C24H40O6Si and a molecular weight of 452.66 g/mol. Its IUPAC name is 3-[(2R,5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-2-yl]prop-2-enoic acid.
| Compound Name | 3-[(2R,5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68753729 |
| Molecular Formula | C24H40O6Si |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 3-[(2R,5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-2-yl]prop-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H]2C=CC[C@H](C=CC(=O)O)O[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C24H40O6Si/c1-24(2,3)31(4,5)28-16-19-18-10-8-9-17(12-13-22(25)26)29-20(18)15-21(19)30-23-11-6-7-14-27-23/h8,10,12-13,17-21,23H,6-7,9,11,14-16H2,1-5H3,(H,25,26)/t17-,18-,19-,20+,21-,23?/m1/s1 |
| InChIKey | YFULLYXKQYUXMW-QNUXKDDWSA-N |
| XLogP | 4.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|